About spiro[3H-1,3-benzothiazole-2,1'-cycloheptane]
spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] (PubChem CID 691411) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is spiro[3H-1,3-benzothiazole-2,1'-cycloheptane].
Molecular Properties
| Compound Name | spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] |
| PubChem CID | 691411 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] |
| SMILES | c1ccc2c(c1)NC1(CCCCCC1)S2 |
| InChI | InChI=1S/C13H17NS/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12(11)15-13/h3-4,7-8,14H,1-2,5-6,9-10H2 |
| InChIKey | PKPWMKHYIZRSHT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-1,3-benzothiazole-2,1'-cycloheptane]?
The IUPAC name of spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] (CID 691411) is spiro[3H-1,3-benzothiazole-2,1'-cycloheptane].
What is the SMILES notation for spiro[3H-1,3-benzothiazole-2,1'-cycloheptane]?
The canonical SMILES for spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] is c1ccc2c(c1)NC1(CCCCCC1)S2.
What is the InChIKey of spiro[3H-1,3-benzothiazole-2,1'-cycloheptane]?
The InChIKey is PKPWMKHYIZRSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12(11)15-13/h3-4,7-8,14H,1-2,5-6,9-10H2.
What are the key properties of spiro[3H-1,3-benzothiazole-2,1'-cycloheptane]?
spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] has a molecular weight of 219.35 g/mol, XLogP of 4.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-1,3-benzothiazole-2,1'-cycloheptane] is sourced from PubChem (CID 691411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).