C23H17FN4O3 — CID 69141229
1-[4-benzoyl-1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69141229) has the molecular formula C23H17FN4O3 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-[4-benzoyl-1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[4-benzoyl-1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69141229 |
| Molecular Formula | C23H17FN4O3 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[4-benzoyl-1-[(4-fluorophenyl)methyl]pyrrol-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(c1ccccc1)c1cc(C(=O)C=C(O)c2ncn[nH]2)n(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H17FN4O3/c24-18-8-6-15(7-9-18)12-28-13-17(22(31)16-4-2-1-3-5-16)10-19(28)20(29)11-21(30)23-25-14-26-27-23/h1-11,13-14,30H,12H2,(H,25,26,27) |
| InChIKey | OGSZXWOFGGDRBS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|