C15H11FN4O2S — CID 69141651
3-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69141651) has the molecular formula C15H11FN4O2S and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69141651 |
| Molecular Formula | C15H11FN4O2S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1nc(Cc2cccc(F)c2)cs1)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11FN4O2S/c16-10-3-1-2-9(4-10)5-11-7-23-13(19-11)6-12(21)14(22)15-17-8-18-20-15/h1-4,7-8H,5-6H2,(H,17,18,20) |
| InChIKey | JQYFQSQEFQBSRE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|