C20H14FN3O2S — CID 69141828
3-[2-[(4-fluorophenyl)methyl]-1-benzothiophen-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69141828) has the molecular formula C20H14FN3O2S and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methyl]-1-benzothiophen-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[2-[(4-fluorophenyl)methyl]-1-benzothiophen-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69141828 |
| Molecular Formula | C20H14FN3O2S |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methyl]-1-benzothiophen-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1c(Cc2ccc(F)cc2)sc2ccccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C20H14FN3O2S/c21-13-7-5-12(6-8-13)9-18-19(14-3-1-2-4-17(14)27-18)15(25)10-16(26)20-22-11-23-24-20/h1-8,10-11,25H,9H2,(H,22,23,24) |
| InChIKey | PMIKFPXSINJRFK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|