C28H32FN3O4 — CID 69142555
2-[2-[[1-(4-amino-2-methylbenzoyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 69142555) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is 2-[2-[[1-(4-amino-2-methylbenzoyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[2-[[1-(4-amino-2-methylbenzoyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69142555 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[2-[[1-(4-amino-2-methylbenzoyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzazepin-5-yl]oxy]ethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1cc(N)ccc1C(=O)N1CCCC(OCCN2C(=O)C3CCCCC3C2=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C28H32FN3O4/c1-17-15-19(30)9-10-20(17)26(33)31-12-4-7-25(23-16-18(29)8-11-24(23)31)36-14-13-32-27(34)21-5-2-3-6-22(21)28(32)35/h8-11,15-16,21-22,25H,2-7,12-14,30H2,1H3 |
| InChIKey | QLGMFQWEXARHMT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|