About [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate
[5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate (PubChem CID 69142592) has the molecular formula C27H28Cl2N4O4
and a molecular weight of 543.45 g/mol. Its IUPAC name is [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate.
Molecular Properties
| Compound Name | [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate |
| PubChem CID | 69142592 |
| Molecular Formula | C27H28Cl2N4O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate |
| SMILES | CCCCOC(=O)Oc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C27H28Cl2N4O4/c1-2-3-17-36-27(35)37-26-24(25(34)32-33-15-5-4-6-16-33)30-22(18-7-11-20(28)12-8-18)23(31-26)19-9-13-21(29)14-10-19/h7-14H,2-6,15-17H2,1H3,(H,32,34) |
| InChIKey | VCOFJYKBJCLYOM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate?
The IUPAC name of [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate (CID 69142592) is [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate.
What is the SMILES notation for [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate?
The canonical SMILES for [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate is CCCCOC(=O)Oc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)NN1CCCCC1.
What is the InChIKey of [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate?
The InChIKey is VCOFJYKBJCLYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28Cl2N4O4/c1-2-3-17-36-27(35)37-26-24(25(34)32-33-15-5-4-6-16-33)30-22(18-7-11-20(28)12-8-18)23(31-26)19-9-13-21(29)14-10-19/h7-14H,2-6,15-17H2,1H3,(H,32,34).
What are the key properties of [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate?
[5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate has a molecular weight of 543.45 g/mol, XLogP of 6.56, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(4-chlorophenyl)-3-(piperidin-1-ylcarbamoyl)pyrazin-2-yl] butyl carbonate is sourced from PubChem (CID 69142592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).