About [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate
[2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate (PubChem CID 69142808) has the molecular formula C22H26F2N2O3
and a molecular weight of 404.46 g/mol. Its IUPAC name is [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
| PubChem CID | 69142808 |
| Molecular Formula | C22H26F2N2O3 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CNCCN1C(=O)OCc1c(F)ccc(OCc2ccccc2C)c1F |
| InChI | InChI=1S/C22H26F2N2O3/c1-3-17-12-25-10-11-26(17)22(27)29-14-18-19(23)8-9-20(21(18)24)28-13-16-7-5-4-6-15(16)2/h4-9,17,25H,3,10-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | HZOLHHVCWZTPNG-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate?
The IUPAC name of [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate (CID 69142808) is [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate.
What is the SMILES notation for [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate?
The canonical SMILES for [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate is CC[C@@H]1CNCCN1C(=O)OCc1c(F)ccc(OCc2ccccc2C)c1F.
What is the InChIKey of [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate?
The InChIKey is HZOLHHVCWZTPNG-QGZVFWFLSA-N. The full InChI is InChI=1S/C22H26F2N2O3/c1-3-17-12-25-10-11-26(17)22(27)29-14-18-19(23)8-9-20(21(18)24)28-13-16-7-5-4-6-15(16)2/h4-9,17,25H,3,10-14H2,1-2H3/t17-/m1/s1.
What are the key properties of [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate?
[2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate has a molecular weight of 404.46 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-difluoro-3-[(2-methylphenyl)methoxy]phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate is sourced from PubChem (CID 69142808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).