About N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide
N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 691436) has the molecular formula C17H13N3O5
and a molecular weight of 339.31 g/mol. Its IUPAC name is N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| PubChem CID | 691436 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H13N3O5/c21-14(18-9-11-5-2-1-3-6-11)10-19-16(22)12-7-4-8-13(20(24)25)15(12)17(19)23/h1-8H,9-10H2,(H,18,21) |
| InChIKey | FWUWZQIUVRXARM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide?
The IUPAC name of N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (CID 691436) is N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
What is the SMILES notation for N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide?
The canonical SMILES for N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide is O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide?
The InChIKey is FWUWZQIUVRXARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O5/c21-14(18-9-11-5-2-1-3-6-11)10-19-16(22)12-7-4-8-13(20(24)25)15(12)17(19)23/h1-8H,9-10H2,(H,18,21).
What are the key properties of N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide?
N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide has a molecular weight of 339.31 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide is sourced from PubChem (CID 691436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).