C23H28O3S — CID 69143673
3-[4-(2-hydroxyethoxy)-3-methylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 69143673) has the molecular formula C23H28O3S and a molecular weight of 384.54 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethoxy)-3-methylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-(2-hydroxyethoxy)-3-methylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 69143673 |
| Molecular Formula | C23H28O3S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[4-(2-hydroxyethoxy)-3-methylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)ccc1OCCO |
| InChI | InChI=1S/C23H28O3S/c1-13-11-15(6-8-19(13)26-10-9-24)5-7-18(25)22-16-12-17-21(23(17,3)4)20(16)14(2)27-22/h6,8,11,17,21,24H,5,7,9-10,12H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | FWYNMEPMLJULGR-DYESRHJHSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |