About [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride
[3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride (PubChem CID 69143854) has the molecular formula C19H27ClF2N2O3
and a molecular weight of 404.89 g/mol. Its IUPAC name is [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride |
| PubChem CID | 69143854 |
| Molecular Formula | C19H27ClF2N2O3 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride |
| SMILES | CC[C@@H]1CNCCN1C(=O)OCc1c(F)ccc(OCC2CCC2)c1F.Cl |
| InChI | InChI=1S/C19H26F2N2O3.ClH/c1-2-14-10-22-8-9-23(14)19(24)26-12-15-16(20)6-7-17(18(15)21)25-11-13-4-3-5-13;/h6-7,13-14,22H,2-5,8-12H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | RGJRFNFZJSZOTK-PFEQFJNWSA-N |
| XLogP | 3.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride?
The IUPAC name of [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride (CID 69143854) is [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride?
The canonical SMILES for [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride is CC[C@@H]1CNCCN1C(=O)OCc1c(F)ccc(OCC2CCC2)c1F.Cl.
What is the InChIKey of [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride?
The InChIKey is RGJRFNFZJSZOTK-PFEQFJNWSA-N. The full InChI is InChI=1S/C19H26F2N2O3.ClH/c1-2-14-10-22-8-9-23(14)19(24)26-12-15-16(20)6-7-17(18(15)21)25-11-13-4-3-5-13;/h6-7,13-14,22H,2-5,8-12H2,1H3;1H/t14-;/m1./s1.
What are the key properties of [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride?
[3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride has a molecular weight of 404.89 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyclobutylmethoxy)-2,6-difluorophenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 69143854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).