About (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride
(2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride (PubChem CID 69143909) has the molecular formula C12H15Cl3N2O2
and a molecular weight of 325.62 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride |
| PubChem CID | 69143909 |
| Molecular Formula | C12H15Cl3N2O2 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H14Cl2N2O2.ClH/c13-10-2-1-9(11(14)7-10)8-18-12(17)16-5-3-15-4-6-16;/h1-2,7,15H,3-6,8H2;1H |
| InChIKey | PIFXEZJAPJQQAF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride?
The IUPAC name of (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride (CID 69143909) is (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride?
The canonical SMILES for (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride is Cl.O=C(OCc1ccc(Cl)cc1Cl)N1CCNCC1.
What is the InChIKey of (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride?
The InChIKey is PIFXEZJAPJQQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O2.ClH/c13-10-2-1-9(11(14)7-10)8-18-12(17)16-5-3-15-4-6-16;/h1-2,7,15H,3-6,8H2;1H.
What are the key properties of (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride?
(2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride has a molecular weight of 325.62 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)methyl piperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 69143909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).