About 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride
5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride (PubChem CID 69144235) has the molecular formula C16H24ClNO2
and a molecular weight of 297.83 g/mol. Its IUPAC name is 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride |
| PubChem CID | 69144235 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride |
| SMILES | CC(CCCN)CC1=COC=C(C2=CC=CCC2)O1.Cl |
| InChI | InChI=1S/C16H23NO2.ClH/c1-13(6-5-9-17)10-15-11-18-12-16(19-15)14-7-3-2-4-8-14;/h2-3,7,11-13H,4-6,8-10,17H2,1H3;1H |
| InChIKey | ONLMDGZQYUQFMX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride?
The IUPAC name of 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride (CID 69144235) is 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride.
What is the SMILES notation for 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride?
The canonical SMILES for 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride is CC(CCCN)CC1=COC=C(C2=CC=CCC2)O1.Cl.
What is the InChIKey of 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride?
The InChIKey is ONLMDGZQYUQFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2.ClH/c1-13(6-5-9-17)10-15-11-18-12-16(19-15)14-7-3-2-4-8-14;/h2-3,7,11-13H,4-6,8-10,17H2,1H3;1H.
What are the key properties of 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride?
5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride has a molecular weight of 297.83 g/mol, XLogP of 4.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-4-methylpentan-1-amine;hydrochloride is sourced from PubChem (CID 69144235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).