About 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea
2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea (PubChem CID 69144370) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea.
Molecular Properties
| Compound Name | 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea |
| PubChem CID | 69144370 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea |
| SMILES | CC(C)Oc1ccc(Oc2ccc(-c3cc(CCNC(N)=O)on3)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-14(2)26-16-7-9-18(10-8-16)27-17-5-3-15(4-6-17)20-13-19(28-24-20)11-12-23-21(22)25/h3-10,13-14H,11-12H2,1-2H3,(H3,22,23,25) |
| InChIKey | UHNPNVUDIYWOAW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea?
The IUPAC name of 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea (CID 69144370) is 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea.
What is the SMILES notation for 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea?
The canonical SMILES for 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea is CC(C)Oc1ccc(Oc2ccc(-c3cc(CCNC(N)=O)on3)cc2)cc1.
What is the InChIKey of 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea?
The InChIKey is UHNPNVUDIYWOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-14(2)26-16-7-9-18(10-8-16)27-17-5-3-15(4-6-17)20-13-19(28-24-20)11-12-23-21(22)25/h3-10,13-14H,11-12H2,1-2H3,(H3,22,23,25).
What are the key properties of 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea?
2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea has a molecular weight of 381.43 g/mol, XLogP of 4.13, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(4-propan-2-yloxyphenoxy)phenyl]-1,2-oxazol-5-yl]ethylurea is sourced from PubChem (CID 69144370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).