C11H12F3N3O4 — CID 69144511
3-[(diaminomethylideneamino)methyl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69144511) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is 3-[(diaminomethylideneamino)methyl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(diaminomethylideneamino)methyl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69144511 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[(diaminomethylideneamino)methyl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCc1cccc(C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H11N3O2.C2HF3O2/c10-9(11)12-5-6-2-1-3-7(4-6)8(13)14;3-2(4,5)1(6)7/h1-4H,5H2,(H,13,14)(H4,10,11,12);(H,6,7) |
| InChIKey | ZRHRZOGYXVOZQQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|