C22H29N5O2S — CID 69144677
N-[6-(4-prop-2-enylpiperazin-1-yl)-3-pyridinyl]-4-pyrrolidin-1-ylbenzenesulfonamide (PubChem CID 69144677) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[6-(4-prop-2-enylpiperazin-1-yl)-3-pyridinyl]-4-pyrrolidin-1-ylbenzenesulfonamide.
| Compound Name | N-[6-(4-prop-2-enylpiperazin-1-yl)-3-pyridinyl]-4-pyrrolidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 69144677 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[6-(4-prop-2-enylpiperazin-1-yl)-3-pyridinyl]-4-pyrrolidin-1-ylbenzenesulfonamide |
| SMILES | C=CCN1CCN(c2ccc(NS(=O)(=O)c3ccc(N4CCCC4)cc3)cn2)CC1 |
| InChI | InChI=1S/C22H29N5O2S/c1-2-11-25-14-16-27(17-15-25)22-10-5-19(18-23-22)24-30(28,29)21-8-6-20(7-9-21)26-12-3-4-13-26/h2,5-10,18,24H,1,3-4,11-17H2 |
| InChIKey | HTVMWGVSKGQCHJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|