C10H12ClNO4 — CID 69145581
3-chloro-4-[(2R)-2,3-dihydroxypropoxy]benzamide (PubChem CID 69145581) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-chloro-4-[(2R)-2,3-dihydroxypropoxy]benzamide.
| Compound Name | 3-chloro-4-[(2R)-2,3-dihydroxypropoxy]benzamide |
|---|---|
| PubChem CID | 69145581 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-chloro-4-[(2R)-2,3-dihydroxypropoxy]benzamide |
| SMILES | NC(=O)c1ccc(OC[C@H](O)CO)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO4/c11-8-3-6(10(12)15)1-2-9(8)16-5-7(14)4-13/h1-3,7,13-14H,4-5H2,(H2,12,15)/t7-/m1/s1 |
| InChIKey | CZVOJVQKHSKUMC-SSDOTTSWSA-N |
| XLogP | 0.17 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |