C15H16Cl2N2 — CID 69145699
2-(3-chlorophenyl)-3-(5-chloro-2-pyridinyl)butan-1-amine (PubChem CID 69145699) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(5-chloro-2-pyridinyl)butan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-3-(5-chloro-2-pyridinyl)butan-1-amine |
|---|---|
| PubChem CID | 69145699 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(5-chloro-2-pyridinyl)butan-1-amine |
| SMILES | CC(c1ccc(Cl)cn1)C(CN)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2/c1-10(15-6-5-13(17)9-19-15)14(8-18)11-3-2-4-12(16)7-11/h2-7,9-10,14H,8,18H2,1H3 |
| InChIKey | CVLYVWXMCZBGBB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |