C31H33FN4O2 — CID 69146130
N-[(1S)-3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(4-fluorophenyl)acetamide (PubChem CID 69146130) has the molecular formula C31H33FN4O2 and a molecular weight of 512.63 g/mol. Its IUPAC name is N-[(1S)-3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(1S)-3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 69146130 |
| Molecular Formula | C31H33FN4O2 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | N-[(1S)-3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1ccnc(C)c1C(=O)N1C=C2CN(CC[C@H](NC(=O)Cc3ccc(F)cc3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C31H33FN4O2/c1-21-12-14-33-22(2)30(21)31(38)36-19-25-17-35(18-26(25)20-36)15-13-28(24-6-4-3-5-7-24)34-29(37)16-23-8-10-27(32)11-9-23/h3-12,14,19,26,28H,13,15-18,20H2,1-2H3,(H,34,37)/t26?,28-/m0/s1 |
| InChIKey | CLWYIZFPKUERQD-RXBHZZDJSA-N |
| XLogP | 4.60 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |