C27H35N5O — CID 6914632
6-ethyl-5-[1-(3-methoxypropyl)-3,4-dihydro-2H-quinolin-7-yl]-4-N-(2-phenylethyl)pyrimidine-2,4-diamine (PubChem CID 6914632) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is 6-ethyl-5-[1-(3-methoxypropyl)-3,4-dihydro-2H-quinolin-7-yl]-4-N-(2-phenylethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[1-(3-methoxypropyl)-3,4-dihydro-2H-quinolin-7-yl]-4-N-(2-phenylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 6914632 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 6-ethyl-5-[1-(3-methoxypropyl)-3,4-dihydro-2H-quinolin-7-yl]-4-N-(2-phenylethyl)pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(NCCc2ccccc2)c1-c1ccc2c(c1)N(CCCOC)CCC2 |
| InChI | InChI=1S/C27H35N5O/c1-3-23-25(26(31-27(28)30-23)29-15-14-20-9-5-4-6-10-20)22-13-12-21-11-7-16-32(24(21)19-22)17-8-18-33-2/h4-6,9-10,12-13,19H,3,7-8,11,14-18H2,1-2H3,(H3,28,29,30,31) |
| InChIKey | DGNIHJBLLNEWQZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|