About bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate
bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate (PubChem CID 69146405) has the molecular formula C18H28N6O3
and a molecular weight of 376.46 g/mol. Its IUPAC name is bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate.
Molecular Properties
| Compound Name | bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate |
| PubChem CID | 69146405 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate |
| SMILES | O.c1cnc(NCC2CCCO2)nc1.c1cnc(NCC2CCCO2)nc1 |
| InChI | InChI=1S/2C9H13N3O.H2O/c2*1-3-8(13-6-1)7-12-9-10-4-2-5-11-9;/h2*2,4-5,8H,1,3,6-7H2,(H,10,11,12);1H2 |
| InChIKey | MDDHBIOFQAUDNB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate?
The IUPAC name of bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate (CID 69146405) is bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate.
What is the SMILES notation for bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate?
The canonical SMILES for bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate is O.c1cnc(NCC2CCCO2)nc1.c1cnc(NCC2CCCO2)nc1.
What is the InChIKey of bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate?
The InChIKey is MDDHBIOFQAUDNB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H13N3O.H2O/c2*1-3-8(13-6-1)7-12-9-10-4-2-5-11-9;/h2*2,4-5,8H,1,3,6-7H2,(H,10,11,12);1H2.
What are the key properties of bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate?
bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate has a molecular weight of 376.46 g/mol, XLogP of 1.31, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-(oxolan-2-ylmethyl)pyrimidin-2-amine);hydrate is sourced from PubChem (CID 69146405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).