C28H41N3O4 — CID 69147381
oxolan-3-yl N-[3-[(3aS)-5-(2-cyclohexylacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate (PubChem CID 69147381) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is oxolan-3-yl N-[3-[(3aS)-5-(2-cyclohexylacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate.
| Compound Name | oxolan-3-yl N-[3-[(3aS)-5-(2-cyclohexylacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 69147381 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | oxolan-3-yl N-[3-[(3aS)-5-(2-cyclohexylacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate |
| SMILES | O=C(NC(CCN1CC2CN(C(=O)CC3CCCCC3)C[C@@H]2C1)c1ccccc1)OC1CCOC1 |
| InChI | InChI=1S/C28H41N3O4/c32-27(15-21-7-3-1-4-8-21)31-18-23-16-30(17-24(23)19-31)13-11-26(22-9-5-2-6-10-22)29-28(33)35-25-12-14-34-20-25/h2,5-6,9-10,21,23-26H,1,3-4,7-8,11-20H2,(H,29,33)/t23-,24?,25?,26?/m0/s1 |
| InChIKey | OAEPYETWBVTWLT-FFRMLBFNSA-N |
| XLogP | 3.99 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |