C14H15N3O6 — CID 69147665
(1S,8R)-4-(ethylcarbamoyloxy)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid (PubChem CID 69147665) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is (1S,8R)-4-(ethylcarbamoyloxy)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid.
| Compound Name | (1S,8R)-4-(ethylcarbamoyloxy)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 69147665 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1S,8R)-4-(ethylcarbamoyloxy)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
| SMILES | CCNC(=O)Oc1ccc2c(c1)[C@H]1CN(C(=O)N1O)[C@H]2C(=O)O |
| InChI | InChI=1S/C14H15N3O6/c1-2-15-13(20)23-7-3-4-8-9(5-7)10-6-16(11(8)12(18)19)14(21)17(10)22/h3-5,10-11,22H,2,6H2,1H3,(H,15,20)(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | CDUHWNWPKCBNSM-GHMZBOCLSA-N |
| XLogP | 1.10 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|