C25H29Cl2N3O2 — CID 69147682
3-chloro-N-[3-[5-(2-chloro-3-methylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide (PubChem CID 69147682) has the molecular formula C25H29Cl2N3O2 and a molecular weight of 474.43 g/mol. Its IUPAC name is 3-chloro-N-[3-[5-(2-chloro-3-methylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[3-[5-(2-chloro-3-methylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69147682 |
| Molecular Formula | C25H29Cl2N3O2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 3-chloro-N-[3-[5-(2-chloro-3-methylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCN2CC3CN(C(=O)c4cccc(C)c4Cl)CC3C2)cc1Cl |
| InChI | InChI=1S/C25H29Cl2N3O2/c1-16-7-8-18(11-22(16)26)24(31)28-9-4-10-29-12-19-14-30(15-20(19)13-29)25(32)21-6-3-5-17(2)23(21)27/h3,5-8,11,19-20H,4,9-10,12-15H2,1-2H3,(H,28,31) |
| InChIKey | RQVPDCLKCHXSCO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|