About (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol
(2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol (PubChem CID 69148039) has the molecular formula C16H24F2N2O
and a molecular weight of 298.38 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol.
Molecular Properties
| Compound Name | (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol |
| PubChem CID | 69148039 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CNC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H24F2N2O/c17-16(18)8-6-13(7-9-16)20-11-15(21)14(19)10-12-4-2-1-3-5-12/h1-5,13-15,20-21H,6-11,19H2/t14-,15+/m0/s1 |
| InChIKey | DDJDDLICDUHCFL-LSDHHAIUSA-N |
| XLogP | 2.08 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol?
The IUPAC name of (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol (CID 69148039) is (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol.
What is the SMILES notation for (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol?
The canonical SMILES for (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol is N[C@@H](Cc1ccccc1)[C@H](O)CNC1CCC(F)(F)CC1.
What is the InChIKey of (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol?
The InChIKey is DDJDDLICDUHCFL-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H24F2N2O/c17-16(18)8-6-13(7-9-16)20-11-15(21)14(19)10-12-4-2-1-3-5-12/h1-5,13-15,20-21H,6-11,19H2/t14-,15+/m0/s1.
What are the key properties of (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol?
(2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol has a molecular weight of 298.38 g/mol, XLogP of 2.08, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-amino-1-[(4,4-difluorocyclohexyl)amino]-4-phenylbutan-2-ol is sourced from PubChem (CID 69148039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).