C23H30N4O — CID 69148489
[2-(3-anilinopropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,4-dimethyl-3-pyridinyl)methanone (PubChem CID 69148489) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is [2-(3-anilinopropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,4-dimethyl-3-pyridinyl)methanone.
| Compound Name | [2-(3-anilinopropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,4-dimethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 69148489 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [2-(3-anilinopropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,4-dimethyl-3-pyridinyl)methanone |
| SMILES | Cc1ccnc(C)c1C(=O)N1CC2CN(CCCNc3ccccc3)CC2C1 |
| InChI | InChI=1S/C23H30N4O/c1-17-9-11-24-18(2)22(17)23(28)27-15-19-13-26(14-20(19)16-27)12-6-10-25-21-7-4-3-5-8-21/h3-5,7-9,11,19-20,25H,6,10,12-16H2,1-2H3 |
| InChIKey | JHFDHHXVJYAZCN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|