C27H28N2O2S2 — CID 6914874
7-methyl-2-(4-phenoxybutylsulfanyl)-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 6914874) has the molecular formula C27H28N2O2S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 7-methyl-2-(4-phenoxybutylsulfanyl)-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-2-(4-phenoxybutylsulfanyl)-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 6914874 |
| Molecular Formula | C27H28N2O2S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 7-methyl-2-(4-phenoxybutylsulfanyl)-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3nc(SCCCCOc4ccccc4)n(-c4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C27H28N2O2S2/c1-19-14-15-22-23(18-19)33-25-24(22)26(30)29(20-10-4-2-5-11-20)27(28-25)32-17-9-8-16-31-21-12-6-3-7-13-21/h2-7,10-13,19H,8-9,14-18H2,1H3 |
| InChIKey | WTIHPVNMQJZVHE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|