C25H29ClFN3O3 — CID 69148945
N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-methoxyacetamide (PubChem CID 69148945) has the molecular formula C25H29ClFN3O3 and a molecular weight of 473.98 g/mol. Its IUPAC name is N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-methoxyacetamide.
| Compound Name | N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 69148945 |
| Molecular Formula | C25H29ClFN3O3 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H](CCN1CC2CN(C(=O)c3c(F)cccc3Cl)CC2C1)c1ccccc1 |
| InChI | InChI=1S/C25H29ClFN3O3/c1-33-16-23(31)28-22(17-6-3-2-4-7-17)10-11-29-12-18-14-30(15-19(18)13-29)25(32)24-20(26)8-5-9-21(24)27/h2-9,18-19,22H,10-16H2,1H3,(H,28,31)/t18?,19?,22-/m0/s1 |
| InChIKey | JDJYXVSEKMRFIG-AJTFCVKESA-N |
| XLogP | 3.38 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |