1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid

C8H8N4O2 — CID 69148967

IUPAC1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid
SMILESCN(C(=O)O)c1nccc2[nH]cnc12
InChIInChI=1S/C8H8N4O2/c1-12(8(13)14)7-6-5(2-3-9-7)10-4-11-6/h2-4H,1H3,(H,10,11)(H,13,14)
InChIKeyCNKILMSOXMKNPP-UHFFFAOYSA-N
MW192.18 g/mol
LogP1.07
Rot. Bonds1

About 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid

1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid (PubChem CID 69148967) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid.

Molecular Properties

Compound Name1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid
PubChem CID69148967
Molecular FormulaC8H8N4O2
Molecular Weight192.18 g/mol
Exact Mass192.06
IUPAC Name1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid
SMILESCN(C(=O)O)c1nccc2[nH]cnc12
InChIInChI=1S/C8H8N4O2/c1-12(8(13)14)7-6-5(2-3-9-7)10-4-11-6/h2-4H,1H3,(H,10,11)(H,13,14)
InChIKeyCNKILMSOXMKNPP-UHFFFAOYSA-N
XLogP1.07
TPSA82.11 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.18
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid?
The IUPAC name of 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid (CID 69148967) is 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid.
What is the SMILES notation for 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid?
The canonical SMILES for 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid is CN(C(=O)O)c1nccc2[nH]cnc12.
What is the InChIKey of 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid?
The InChIKey is CNKILMSOXMKNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c1-12(8(13)14)7-6-5(2-3-9-7)10-4-11-6/h2-4H,1H3,(H,10,11)(H,13,14).
What are the key properties of 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid?
1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid has a molecular weight of 192.18 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-c]pyridin-4-yl(methyl)carbamic acid is sourced from PubChem (CID 69148967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).