C22H23ClF2N4 — CID 69149885
N'-[2-[2-(4-chlorophenyl)ethenyl]-6,7-difluoroquinazolin-4-yl]hexane-1,6-diamine (PubChem CID 69149885) has the molecular formula C22H23ClF2N4 and a molecular weight of 416.90 g/mol. Its IUPAC name is N'-[2-[2-(4-chlorophenyl)ethenyl]-6,7-difluoroquinazolin-4-yl]hexane-1,6-diamine.
| Compound Name | N'-[2-[2-(4-chlorophenyl)ethenyl]-6,7-difluoroquinazolin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 69149885 |
| Molecular Formula | C22H23ClF2N4 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N'-[2-[2-(4-chlorophenyl)ethenyl]-6,7-difluoroquinazolin-4-yl]hexane-1,6-diamine |
| SMILES | NCCCCCCNc1nc(C=Cc2ccc(Cl)cc2)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C22H23ClF2N4/c23-16-8-5-15(6-9-16)7-10-21-28-20-14-19(25)18(24)13-17(20)22(29-21)27-12-4-2-1-3-11-26/h5-10,13-14H,1-4,11-12,26H2,(H,27,28,29) |
| InChIKey | YDEHCDKAJXQFEB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|