C32H27N3O6S — CID 69150203
(2S)-2-[[1-(1-benzofuran-2-carbonylamino)-4-phenylcyclohexa-2,5-dien-1-yl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 69150203) has the molecular formula C32H27N3O6S and a molecular weight of 581.65 g/mol. Its IUPAC name is (2S)-2-[[1-(1-benzofuran-2-carbonylamino)-4-phenylcyclohexa-2,5-dien-1-yl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[1-(1-benzofuran-2-carbonylamino)-4-phenylcyclohexa-2,5-dien-1-yl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 69150203 |
| Molecular Formula | C32H27N3O6S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | (2S)-2-[[1-(1-benzofuran-2-carbonylamino)-4-phenylcyclohexa-2,5-dien-1-yl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(NC1(S(=O)(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)C=CC(c2ccccc2)C=C1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C32H27N3O6S/c36-30(29-19-23-10-4-7-13-28(23)41-29)34-32(16-14-22(15-17-32)21-8-2-1-3-9-21)42(39,40)35-27(31(37)38)18-24-20-33-26-12-6-5-11-25(24)26/h1-17,19-20,22,27,33,35H,18H2,(H,34,36)(H,37,38)/t22?,27-,32?/m0/s1 |
| InChIKey | LNPVZQZWPNKRHQ-OWDVRYIHSA-N |
| XLogP | 4.87 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|