About N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride
N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride (PubChem CID 69150434) has the molecular formula C21H25Cl3N4
and a molecular weight of 439.82 g/mol. Its IUPAC name is N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride |
| PubChem CID | 69150434 |
| Molecular Formula | C21H25Cl3N4 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCNc1nc(C=Cc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H23ClN4.2ClH/c22-17-11-8-16(9-12-17)10-13-20-25-19-7-3-2-6-18(19)21(26-20)24-15-5-1-4-14-23;;/h2-3,6-13H,1,4-5,14-15,23H2,(H,24,25,26);2*1H |
| InChIKey | NVERYRKSFYMVCL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride?
The IUPAC name of N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride (CID 69150434) is N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride.
What is the SMILES notation for N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride?
The canonical SMILES for N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride is Cl.Cl.NCCCCCNc1nc(C=Cc2ccc(Cl)cc2)nc2ccccc12.
What is the InChIKey of N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride?
The InChIKey is NVERYRKSFYMVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClN4.2ClH/c22-17-11-8-16(9-12-17)10-13-20-25-19-7-3-2-6-18(19)21(26-20)24-15-5-1-4-14-23;;/h2-3,6-13H,1,4-5,14-15,23H2,(H,24,25,26);2*1H.
What are the key properties of N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride?
N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride has a molecular weight of 439.82 g/mol, XLogP of 5.84, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]pentane-1,5-diamine;dihydrochloride is sourced from PubChem (CID 69150434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).