About 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole
1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 69151006) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole.
Analyze 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole?
The IUPAC name of 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole (CID 69151006) is 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole.
What is the SMILES notation for 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole?
The canonical SMILES for 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole is CN1CCC2CNC=C21.
What is the InChIKey of 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole?
The InChIKey is WOFUXFRVLSHZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-9-3-2-6-4-8-5-7(6)9/h5-6,8H,2-4H2,1H3.
What are the key properties of 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole?
1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole has a molecular weight of 124.19 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,3a,4,5-tetrahydro-2H-pyrrolo[2,3-c]pyrrole is sourced from PubChem (CID 69151006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).