C8H15N3S — CID 69151207
N,N'-dimethyl-N'-(1,3-thiazol-2-yl)propane-1,3-diamine (PubChem CID 69151207) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(1,3-thiazol-2-yl)propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-N'-(1,3-thiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 69151207 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N,N'-dimethyl-N'-(1,3-thiazol-2-yl)propane-1,3-diamine |
| SMILES | CNCCCN(C)c1nccs1 |
| InChI | InChI=1S/C8H15N3S/c1-9-4-3-6-11(2)8-10-5-7-12-8/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | MIUMQVHWCYZFLJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|