About 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea
1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 69151484) has the molecular formula C22H15Cl3N4O2
and a molecular weight of 473.75 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 69151484 |
| Molecular Formula | C22H15Cl3N4O2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc2c(Cc3ccc(Cl)cc3)n[nH]c(=O)c2c1 |
| InChI | InChI=1S/C22H15Cl3N4O2/c23-13-3-1-12(2-4-13)9-20-16-7-5-14(10-17(16)21(30)29-28-20)26-22(31)27-15-6-8-18(24)19(25)11-15/h1-8,10-11H,9H2,(H,29,30)(H2,26,27,31) |
| InChIKey | NNYWEQYKRIPCJF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea?
The IUPAC name of 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea (CID 69151484) is 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea is O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc2c(Cc3ccc(Cl)cc3)n[nH]c(=O)c2c1.
What is the InChIKey of 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea?
The InChIKey is NNYWEQYKRIPCJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl3N4O2/c23-13-3-1-12(2-4-13)9-20-16-7-5-14(10-17(16)21(30)29-28-20)26-22(31)27-15-6-8-18(24)19(25)11-15/h1-8,10-11H,9H2,(H,29,30)(H2,26,27,31).
What are the key properties of 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea?
1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea has a molecular weight of 473.75 g/mol, XLogP of 6.12, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(4-chlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 69151484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).