C25H24ClN5O4 — CID 69151766
2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetic acid (PubChem CID 69151766) has the molecular formula C25H24ClN5O4 and a molecular weight of 493.95 g/mol. Its IUPAC name is 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 69151766 |
| Molecular Formula | C25H24ClN5O4 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1cnc(NNC(=O)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C25H24ClN5O4/c1-31(14-21(32)33)24(34)17-12-20(26)23(27-13-17)29-30-25(35)28-22-18-8-4-2-6-15(18)10-11-16-7-3-5-9-19(16)22/h2-9,12-13,22H,10-11,14H2,1H3,(H,27,29)(H,32,33)(H2,28,30,35) |
| InChIKey | AGGSEOKCJLDDMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|