C12H20N2 — CID 69151806
1-N,1-N-dimethyl-4-phenylbutane-1,2-diamine (PubChem CID 69151806) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-phenylbutane-1,2-diamine.
| Compound Name | 1-N,1-N-dimethyl-4-phenylbutane-1,2-diamine |
|---|---|
| PubChem CID | 69151806 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N,1-N-dimethyl-4-phenylbutane-1,2-diamine |
| SMILES | CN(C)CC(N)CCc1ccccc1 |
| InChI | InChI=1S/C12H20N2/c1-14(2)10-12(13)9-8-11-6-4-3-5-7-11/h3-7,12H,8-10,13H2,1-2H3 |
| InChIKey | IXMVOVJULRXOEV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |