About 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea
1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea (PubChem CID 69152074) has the molecular formula C21H15Cl2N5O2
and a molecular weight of 440.29 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea.
Molecular Properties
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea |
| PubChem CID | 69152074 |
| Molecular Formula | C21H15Cl2N5O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)Nc1ccc2c(Cc3ccc(Cl)cc3Cl)n[nH]c(=O)c2c1 |
| InChI | InChI=1S/C21H15Cl2N5O2/c22-13-4-3-12(18(23)9-13)8-19-16-6-5-14(10-17(16)20(29)28-27-19)25-21(30)26-15-2-1-7-24-11-15/h1-7,9-11H,8H2,(H,28,29)(H2,25,26,30) |
| InChIKey | QRALWZHEBPYFSF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea?
The IUPAC name of 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea (CID 69152074) is 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea.
What is the SMILES notation for 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea?
The canonical SMILES for 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea is O=C(Nc1cccnc1)Nc1ccc2c(Cc3ccc(Cl)cc3Cl)n[nH]c(=O)c2c1.
What is the InChIKey of 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea?
The InChIKey is QRALWZHEBPYFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2N5O2/c22-13-4-3-12(18(23)9-13)8-19-16-6-5-14(10-17(16)20(29)28-27-19)25-21(30)26-15-2-1-7-24-11-15/h1-7,9-11H,8H2,(H,28,29)(H2,25,26,30).
What are the key properties of 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea?
1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea has a molecular weight of 440.29 g/mol, XLogP of 4.86, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2,4-dichlorophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea is sourced from PubChem (CID 69152074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).