C31H30N2 — CID 69152193
1,2,3,6-tetramethyl-7-[(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)methyl]cyclopenta[b]indole (PubChem CID 69152193) has the molecular formula C31H30N2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-7-[(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)methyl]cyclopenta[b]indole.
| Compound Name | 1,2,3,6-tetramethyl-7-[(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)methyl]cyclopenta[b]indole |
|---|---|
| PubChem CID | 69152193 |
| Molecular Formula | C31H30N2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1,2,3,6-tetramethyl-7-[(1,2,3,6-tetramethylcyclopenta[b]indol-7-yl)methyl]cyclopenta[b]indole |
| SMILES | CC1=C(C)C(C)=C2C1=Nc1cc(C)c(Cc3cc4c(cc3C)N=C3C(C)=C(C)C(C)=C34)cc12 |
| InChI | InChI=1S/C31H30N2/c1-14-9-26-24(28-18(5)16(3)20(7)30(28)32-26)12-22(14)11-23-13-25-27(10-15(23)2)33-31-21(8)17(4)19(6)29(25)31/h9-10,12-13H,11H2,1-8H3 |
| InChIKey | KRVGGHPKMWUWLR-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |