C14H14N4 — CID 69152446
3-methyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaene (PubChem CID 69152446) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-methyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaene.
| Compound Name | 3-methyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaene |
|---|---|
| PubChem CID | 69152446 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-methyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaene |
| SMILES | Cc1cccc2ncc3nc4n(c3c12)CCNC4 |
| InChI | InChI=1S/C14H14N4/c1-9-3-2-4-10-13(9)14-11(7-16-10)17-12-8-15-5-6-18(12)14/h2-4,7,15H,5-6,8H2,1H3 |
| InChIKey | AUXNNVGAHWTBNY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |