About 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one
8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one (PubChem CID 69152524) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one.
Molecular Properties
| Compound Name | 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one |
| PubChem CID | 69152524 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one |
| SMILES | O=C1CC2CCC(C1)N2.O=C1CCNCC1 |
| InChI | InChI=1S/C7H11NO.C5H9NO/c9-7-3-5-1-2-6(4-7)8-5;7-5-1-3-6-4-2-5/h5-6,8H,1-4H2;6H,1-4H2 |
| InChIKey | XKNBLMZRASJCPQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one?
The IUPAC name of 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one (CID 69152524) is 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one.
What is the SMILES notation for 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one?
The canonical SMILES for 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one is O=C1CC2CCC(C1)N2.O=C1CCNCC1.
What is the InChIKey of 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one?
The InChIKey is XKNBLMZRASJCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C5H9NO/c9-7-3-5-1-2-6(4-7)8-5;7-5-1-3-6-4-2-5/h5-6,8H,1-4H2;6H,1-4H2.
What are the key properties of 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one?
8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one has a molecular weight of 224.30 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azabicyclo[3.2.1]octan-3-one;piperidin-4-one is sourced from PubChem (CID 69152524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).