About methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate
methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate (PubChem CID 69152755) has the molecular formula C24H34N4O4
and a molecular weight of 442.56 g/mol. Its IUPAC name is methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate |
| PubChem CID | 69152755 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(N(Cc2cc(OC(C)C)cc(OC(C)C)c2)C2CCNCC2)n1 |
| InChI | InChI=1S/C24H34N4O4/c1-16(2)31-20-12-18(13-21(14-20)32-17(3)4)15-28(19-6-9-25-10-7-19)24-26-11-8-22(27-24)23(29)30-5/h8,11-14,16-17,19,25H,6-7,9-10,15H2,1-5H3 |
| InChIKey | QYPUXLHFLRYSFB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate?
The IUPAC name of methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate (CID 69152755) is methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate.
What is the SMILES notation for methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate?
The canonical SMILES for methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate is COC(=O)c1ccnc(N(Cc2cc(OC(C)C)cc(OC(C)C)c2)C2CCNCC2)n1.
What is the InChIKey of methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate?
The InChIKey is QYPUXLHFLRYSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N4O4/c1-16(2)31-20-12-18(13-21(14-20)32-17(3)4)15-28(19-6-9-25-10-7-19)24-26-11-8-22(27-24)23(29)30-5/h8,11-14,16-17,19,25H,6-7,9-10,15H2,1-5H3.
What are the key properties of methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate?
methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate has a molecular weight of 442.56 g/mol, XLogP of 3.60, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[3,5-di(propan-2-yloxy)phenyl]methyl-piperidin-4-ylamino]pyrimidine-4-carboxylate is sourced from PubChem (CID 69152755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).