C19H18N2O2 — CID 69152859
(1S,2R,6S,7R)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 69152859) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,6S,7R)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 69152859 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (1S,2R,6S,7R)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | Cc1cc(=O)[nH]c2cc(N3C[C@@H]4[C@H](C3=O)[C@@H]3C=C[C@H]4C3)ccc12 |
| InChI | InChI=1S/C19H18N2O2/c1-10-6-17(22)20-16-8-13(4-5-14(10)16)21-9-15-11-2-3-12(7-11)18(15)19(21)23/h2-6,8,11-12,15,18H,7,9H2,1H3,(H,20,22)/t11-,12+,15-,18+/m0/s1 |
| InChIKey | JSOKBFXFNBRLAV-ZQUVKOLYSA-N |
| XLogP | 2.62 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|