About 6-amino-1-methyl-2H-1,4-diazepin-7-one
6-amino-1-methyl-2H-1,4-diazepin-7-one (PubChem CID 69152906) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 6-amino-1-methyl-2H-1,4-diazepin-7-one.
Molecular Properties
| Compound Name | 6-amino-1-methyl-2H-1,4-diazepin-7-one |
| PubChem CID | 69152906 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 6-amino-1-methyl-2H-1,4-diazepin-7-one |
| SMILES | CN1CC=NC=C(N)C1=O |
| InChI | InChI=1S/C6H9N3O/c1-9-3-2-8-4-5(7)6(9)10/h2,4H,3,7H2,1H3 |
| InChIKey | ONKBPMPCQNMBNA-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1-methyl-2H-1,4-diazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-methyl-2H-1,4-diazepin-7-one?
The IUPAC name of 6-amino-1-methyl-2H-1,4-diazepin-7-one (CID 69152906) is 6-amino-1-methyl-2H-1,4-diazepin-7-one.
What is the SMILES notation for 6-amino-1-methyl-2H-1,4-diazepin-7-one?
The canonical SMILES for 6-amino-1-methyl-2H-1,4-diazepin-7-one is CN1CC=NC=C(N)C1=O.
What is the InChIKey of 6-amino-1-methyl-2H-1,4-diazepin-7-one?
The InChIKey is ONKBPMPCQNMBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-9-3-2-8-4-5(7)6(9)10/h2,4H,3,7H2,1H3.
What are the key properties of 6-amino-1-methyl-2H-1,4-diazepin-7-one?
6-amino-1-methyl-2H-1,4-diazepin-7-one has a molecular weight of 139.16 g/mol, XLogP of -0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-2H-1,4-diazepin-7-one is sourced from PubChem (CID 69152906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).