C13H16O — CID 69153329
2,3,4,4a,6,6a-hexahydro-1H-benzo[c]chromene (PubChem CID 69153329) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,3,4,4a,6,6a-hexahydro-1H-benzo[c]chromene.
| Compound Name | 2,3,4,4a,6,6a-hexahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 69153329 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2,3,4,4a,6,6a-hexahydro-1H-benzo[c]chromene |
| SMILES | C1=CC2=C3CCCCC3OCC2C=C1 |
| InChI | InChI=1S/C13H16O/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-2,5-6,10,13H,3-4,7-9H2 |
| InChIKey | GFQDYWPIUNTNSI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |