About 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride
2H-1,3-thiazole-3-carboxylic acid;dihydrochloride (PubChem CID 69153549) has the molecular formula C4H7Cl2NO2S
and a molecular weight of 204.08 g/mol. Its IUPAC name is 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride |
| PubChem CID | 69153549 |
| Molecular Formula | C4H7Cl2NO2S |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 202.96 |
| IUPAC Name | 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)N1C=CSC1 |
| InChI | InChI=1S/C4H5NO2S.2ClH/c6-4(7)5-1-2-8-3-5;;/h1-2H,3H2,(H,6,7);2*1H |
| InChIKey | MCBPQTYZGKPWPU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride?
The IUPAC name of 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride (CID 69153549) is 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride.
What is the SMILES notation for 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride?
The canonical SMILES for 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride is Cl.Cl.O=C(O)N1C=CSC1.
What is the InChIKey of 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride?
The InChIKey is MCBPQTYZGKPWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S.2ClH/c6-4(7)5-1-2-8-3-5;;/h1-2H,3H2,(H,6,7);2*1H.
What are the key properties of 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride?
2H-1,3-thiazole-3-carboxylic acid;dihydrochloride has a molecular weight of 204.08 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-thiazole-3-carboxylic acid;dihydrochloride is sourced from PubChem (CID 69153549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).