About 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide
2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide (PubChem CID 69153566) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide |
| PubChem CID | 69153566 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(C2=NCCN2)CC1 |
| InChI | InChI=1S/C10H18N4O/c11-9(15)7-8-1-5-14(6-2-8)10-12-3-4-13-10/h8H,1-7H2,(H2,11,15)(H,12,13) |
| InChIKey | BJKRCCPTTBCYFI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide?
The IUPAC name of 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide (CID 69153566) is 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide.
What is the SMILES notation for 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide?
The canonical SMILES for 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide is NC(=O)CC1CCN(C2=NCCN2)CC1.
What is the InChIKey of 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide?
The InChIKey is BJKRCCPTTBCYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c11-9(15)7-8-1-5-14(6-2-8)10-12-3-4-13-10/h8H,1-7H2,(H2,11,15)(H,12,13).
What are the key properties of 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide?
2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide has a molecular weight of 210.28 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]acetamide is sourced from PubChem (CID 69153566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).