About (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate
(6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate (PubChem CID 69153636) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate |
| PubChem CID | 69153636 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate |
| SMILES | Cc1ccc2c(OC(=O)N3CCC(C)CC3)noc2n1 |
| InChI | InChI=1S/C14H17N3O3/c1-9-5-7-17(8-6-9)14(18)19-13-11-4-3-10(2)15-12(11)20-16-13/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | YQECVAFDZVBUKV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate?
The IUPAC name of (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate (CID 69153636) is (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate.
What is the SMILES notation for (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate?
The canonical SMILES for (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate is Cc1ccc2c(OC(=O)N3CCC(C)CC3)noc2n1.
What is the InChIKey of (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate?
The InChIKey is YQECVAFDZVBUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-9-5-7-17(8-6-9)14(18)19-13-11-4-3-10(2)15-12(11)20-16-13/h3-4,9H,5-8H2,1-2H3.
What are the key properties of (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate?
(6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate has a molecular weight of 275.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-yl) 4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 69153636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).