About tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate
tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate (PubChem CID 69153712) has the molecular formula C15H28N4O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate |
| PubChem CID | 69153712 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CCN(C2=NCCN2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-15(2,3)21-14(20)18-7-4-12-5-10-19(11-6-12)13-16-8-9-17-13/h12H,4-11H2,1-3H3,(H,16,17)(H,18,20) |
| InChIKey | NDPYBLFYUDUETM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate (CID 69153712) is tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate is CC(C)(C)OC(=O)NCCC1CCN(C2=NCCN2)CC1.
What is the InChIKey of tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate?
The InChIKey is NDPYBLFYUDUETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O2/c1-15(2,3)21-14(20)18-7-4-12-5-10-19(11-6-12)13-16-8-9-17-13/h12H,4-11H2,1-3H3,(H,16,17)(H,18,20).
What are the key properties of tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate?
tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate has a molecular weight of 296.41 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-4-yl]ethyl]carbamate is sourced from PubChem (CID 69153712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).