C19H17F3N2O2S — CID 69153889
[2,6-diethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate (PubChem CID 69153889) has the molecular formula C19H17F3N2O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is [2,6-diethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate.
| Compound Name | [2,6-diethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 69153889 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [2,6-diethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate |
| SMILES | CCc1nc(CC)c(OC(C)=O)cc1Cc1nc2c(F)c(F)cc(F)c2s1 |
| InChI | InChI=1S/C19H17F3N2O2S/c1-4-13-10(6-15(26-9(3)25)14(5-2)23-13)7-16-24-18-17(22)11(20)8-12(21)19(18)27-16/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | ZPTYMCQGZHNQDT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|