About ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate
ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate (PubChem CID 69153942) has the molecular formula C21H22N6O6
and a molecular weight of 454.44 g/mol. Its IUPAC name is ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate.
Molecular Properties
| Compound Name | ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate |
| PubChem CID | 69153942 |
| Molecular Formula | C21H22N6O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate |
| SMILES | CCOC(=O)OC1CCN(c2nc(Oc3ccc(-n4cncn4)cc3)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22N6O6/c1-2-31-21(28)33-17-9-11-25(12-10-17)20-18(27(29)30)7-8-19(24-20)32-16-5-3-15(4-6-16)26-14-22-13-23-26/h3-8,13-14,17H,2,9-12H2,1H3 |
| InChIKey | HTCUCRLQGJHFCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate?
The IUPAC name of ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate (CID 69153942) is ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate.
What is the SMILES notation for ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate?
The canonical SMILES for ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate is CCOC(=O)OC1CCN(c2nc(Oc3ccc(-n4cncn4)cc3)ccc2[N+](=O)[O-])CC1.
What is the InChIKey of ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate?
The InChIKey is HTCUCRLQGJHFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6O6/c1-2-31-21(28)33-17-9-11-25(12-10-17)20-18(27(29)30)7-8-19(24-20)32-16-5-3-15(4-6-16)26-14-22-13-23-26/h3-8,13-14,17H,2,9-12H2,1H3.
What are the key properties of ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate?
ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate has a molecular weight of 454.44 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [1-[3-nitro-6-[4-(1,2,4-triazol-1-yl)phenoxy]-2-pyridinyl]piperidin-4-yl] carbonate is sourced from PubChem (CID 69153942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).